3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoic acid
Chemical Structure Depiction of
3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoic acid
3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoic acid
Building block characteristics
| Compound ID: | BB17-0371 |
| Compound Name: | 3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enoic acid |
| Molecular Weight: | 283.11 |
| Molecular Formula: | C13 H8 Cl2 O3 |
| MFCD Number: | MFCD05797689 |
| Smiles: | C(=C/c1ccc(c2cc(cc(c2)[Cl])[Cl])o1)\C(O)=O |