3-ethyl-6-(4-methylphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Chemical Structure Depiction of
3-ethyl-6-(4-methylphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
3-ethyl-6-(4-methylphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole
Building block characteristics
| Compound ID: | BB17-0954 |
| Compound Name: | 3-ethyl-6-(4-methylphenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| Molecular Weight: | 244.32 |
| Molecular Formula: | C12 H12 N4 S |
| MFCD Number: | MFCD22192878 |
| Smiles: | CCc1nnc2n1nc(c1ccc(C)cc1)s2 |