5-[3,5-bis(trifluoromethyl)phenyl]furan-2-carbaldehyde
Chemical Structure Depiction of
5-[3,5-bis(trifluoromethyl)phenyl]furan-2-carbaldehyde
5-[3,5-bis(trifluoromethyl)phenyl]furan-2-carbaldehyde
Building block characteristics
| Compound ID: | BB17-0972 |
| Compound Name: | 5-[3,5-bis(trifluoromethyl)phenyl]furan-2-carbaldehyde |
| Molecular Weight: | 308.18 |
| Molecular Formula: | C13 H6 F6 O2 |
| CAS Number: | 256658-04-5 |
| MFCD Number: | MFCD00173833 |
| Smiles: | C(c1ccc(c2cc(cc(c2)C(F)(F)F)C(F)(F)F)o1)=O |