4-[(3,4-dichlorophenyl)methoxy]-3-ethoxybenzonitrile
Chemical Structure Depiction of
4-[(3,4-dichlorophenyl)methoxy]-3-ethoxybenzonitrile
4-[(3,4-dichlorophenyl)methoxy]-3-ethoxybenzonitrile
Building block characteristics
| Compound ID: | BB17-2122 |
| Compound Name: | 4-[(3,4-dichlorophenyl)methoxy]-3-ethoxybenzonitrile |
| Molecular Weight: | 322.19 |
| Molecular Formula: | C16 H13 Cl2 N O2 |
| MFCD Number: | MFCD09714693 |
| Smiles: | CCOc1cc(C#N)ccc1OCc1ccc(c(c1)[Cl])[Cl] |