1-[(2-chloro-6-fluorophenyl)methyl]-1H-indole-5-carboxylic acid
Chemical Structure Depiction of
1-[(2-chloro-6-fluorophenyl)methyl]-1H-indole-5-carboxylic acid
1-[(2-chloro-6-fluorophenyl)methyl]-1H-indole-5-carboxylic acid
Building block characteristics
| Compound ID: | BB17-2622 |
| Compound Name: | 1-[(2-chloro-6-fluorophenyl)methyl]-1H-indole-5-carboxylic acid |
| Molecular Weight: | 303.72 |
| Molecular Formula: | C16 H11 Cl F N O2 |
| MFCD Number: | MFCD30713190 |
| Smiles: | C(c1c(cccc1[Cl])F)n1ccc2cc(ccc12)C(O)=O |