3-(3-amino-4-chlorophenyl)prop-2-enoic acid
Chemical Structure Depiction of
3-(3-amino-4-chlorophenyl)prop-2-enoic acid
3-(3-amino-4-chlorophenyl)prop-2-enoic acid
Building block characteristics
| Compound ID: | BB17-2789 |
| Compound Name: | 3-(3-amino-4-chlorophenyl)prop-2-enoic acid |
| Molecular Weight: | 197.62 |
| Molecular Formula: | C9 H8 Cl N O2 |
| CAS Number: | 1262014-52-7 |
| MFCD Number: | MFCD18389489 |
| Smiles: | C(=C/c1ccc(c(c1)N)[Cl])\C(O)=O |