3-(2,3-difluorophenyl)prop-2-enoic acid
Chemical Structure Depiction of
3-(2,3-difluorophenyl)prop-2-enoic acid
3-(2,3-difluorophenyl)prop-2-enoic acid
Building block characteristics
| Compound ID: | BB20-4935 |
| Compound Name: | 3-(2,3-difluorophenyl)prop-2-enoic acid |
| Molecular Weight: | 184.14 |
| Molecular Formula: | C9 H6 F2 O2 |
| CAS Number: | 207981-48-4 |
| MFCD Number: | MFCD00061291 |
| Smiles: | C(=C/c1cccc(c1F)F)\C(O)=O |