tert-butyl [2-(2-fluorophenyl)propan-2-yl]carbamate
Chemical Structure Depiction of
tert-butyl [2-(2-fluorophenyl)propan-2-yl]carbamate
tert-butyl [2-(2-fluorophenyl)propan-2-yl]carbamate
Building block characteristics
| Compound ID: | BB35-1291 |
| Compound Name: | tert-butyl [2-(2-fluorophenyl)propan-2-yl]carbamate |
| Molecular Weight: | 253.31 |
| Molecular Formula: | C14 H20 F N O2 |
| CAS Number: | 1286275-05-5 |
| MFCD Number: | MFCD18785694 |
| Smiles: | CC(C)(c1ccccc1F)NC(=O)OC(C)(C)C |