methyl 2-(chloromethyl)-5-methoxy-1-(4-methylphenyl)-1H-indole-3-carboxylate
Chemical Structure Depiction of
methyl 2-(chloromethyl)-5-methoxy-1-(4-methylphenyl)-1H-indole-3-carboxylate
methyl 2-(chloromethyl)-5-methoxy-1-(4-methylphenyl)-1H-indole-3-carboxylate
Building block characteristics
| Compound ID: | BB51-0577 |
| Compound Name: | methyl 2-(chloromethyl)-5-methoxy-1-(4-methylphenyl)-1H-indole-3-carboxylate |
| Molecular Weight: | 343.81 |
| Molecular Formula: | C19 H18 Cl N O3 |
| MFCD Number: | MFCD15730252 |
| Smiles: | Cc1ccc(cc1)n1c(C[Cl])c(C(=O)OC)c2cc(ccc12)OC |