4-formyl-2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid
Chemical Structure Depiction of
4-formyl-2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid
4-formyl-2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid
Building block characteristics
| Compound ID: | BB51-1119 |
| Compound Name: | 4-formyl-2,5-dimethyl-1-(4-methylphenyl)-1H-pyrrole-3-carboxylic acid |
| Molecular Weight: | 257.29 |
| Molecular Formula: | C15 H15 N O3 |
| MFCD Number: | MFCD15730597 |
| Smiles: | Cc1ccc(cc1)n1c(C)c(C=O)c(C(O)=O)c1C |