4-ethyl-5-(1H-indol-1-yl)thiophene-2-carboxylic acid
Chemical Structure Depiction of
4-ethyl-5-(1H-indol-1-yl)thiophene-2-carboxylic acid
4-ethyl-5-(1H-indol-1-yl)thiophene-2-carboxylic acid
Building block characteristics
| Compound ID: | BB51-2384 |
| Compound Name: | 4-ethyl-5-(1H-indol-1-yl)thiophene-2-carboxylic acid |
| Molecular Weight: | 271.34 |
| Molecular Formula: | C15 H13 N O2 S |
| MFCD Number: | MFCD16991757 |
| Smiles: | CCc1cc(C(O)=O)sc1n1ccc2ccccc12 |