1,3-dihydroxy-6H-dibenzo[b,d]pyran-6-one
Chemical Structure Depiction of
1,3-dihydroxy-6H-dibenzo[b,d]pyran-6-one
1,3-dihydroxy-6H-dibenzo[b,d]pyran-6-one
Building block characteristics
| Compound ID: | BB52-0470 |
| Compound Name: | 1,3-dihydroxy-6H-dibenzo[b,d]pyran-6-one |
| Molecular Weight: | 228.2 |
| Molecular Formula: | C13 H8 O4 |
| CAS Number: | 54245-10-2 |
| MFCD Number: | MFCD01325155 |
| Smiles: | c1ccc2c(c1)C(=O)Oc1cc(cc(c12)O)O |