N~4~-(3-chlorophenyl)-2-(2-methoxyethyl)pyrimidine-4,6-diamine
Chemical Structure Depiction of
N~4~-(3-chlorophenyl)-2-(2-methoxyethyl)pyrimidine-4,6-diamine
N~4~-(3-chlorophenyl)-2-(2-methoxyethyl)pyrimidine-4,6-diamine
Building block characteristics
| Compound ID: | BB52-2566 |
| Compound Name: | N~4~-(3-chlorophenyl)-2-(2-methoxyethyl)pyrimidine-4,6-diamine |
| Molecular Weight: | 278.74 |
| Molecular Formula: | C13 H15 Cl N4 O |
| MFCD Number: | MFCD15731076 |
| Smiles: | COCCc1nc(cc(Nc2cccc(c2)[Cl])n1)N |