ethyl 1-(4-fluorophenyl)-4-formyl-1H-pyrazole-3-carboxylate
Chemical Structure Depiction of
ethyl 1-(4-fluorophenyl)-4-formyl-1H-pyrazole-3-carboxylate
ethyl 1-(4-fluorophenyl)-4-formyl-1H-pyrazole-3-carboxylate
Building block characteristics
| Compound ID: | BB52-3372 |
| Compound Name: | ethyl 1-(4-fluorophenyl)-4-formyl-1H-pyrazole-3-carboxylate |
| Molecular Weight: | 262.24 |
| Molecular Formula: | C13 H11 F N2 O3 |
| CAS Number: | 1159691-42-5 |
| MFCD Number: | MFCD11559138 |
| Smiles: | CCOC(c1c(C=O)cn(c2ccc(cc2)F)n1)=O |