1-(3-methylphenyl)-1H-1,2,3-triazole-5-carboxylic acid
Chemical Structure Depiction of
1-(3-methylphenyl)-1H-1,2,3-triazole-5-carboxylic acid
1-(3-methylphenyl)-1H-1,2,3-triazole-5-carboxylic acid
Building block characteristics
| Compound ID: | BB52-3445 |
| Compound Name: | 1-(3-methylphenyl)-1H-1,2,3-triazole-5-carboxylic acid |
| Molecular Weight: | 203.2 |
| Molecular Formula: | C10 H9 N3 O2 |
| MFCD Number: | MFCD11559215 |
| Smiles: | Cc1cccc(c1)n1c(cnn1)C(O)=O |