ethyl 4-[(4-ethylphenyl)methyl]-2-methyl-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 4-[(4-ethylphenyl)methyl]-2-methyl-1H-pyrrole-3-carboxylate
ethyl 4-[(4-ethylphenyl)methyl]-2-methyl-1H-pyrrole-3-carboxylate
Building block characteristics
| Compound ID: | BB52-3682 |
| Compound Name: | ethyl 4-[(4-ethylphenyl)methyl]-2-methyl-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 271.36 |
| Molecular Formula: | C17 H21 N O2 |
| MFCD Number: | MFCD07528497 |
| Smiles: | CCc1ccc(Cc2c[nH]c(C)c2C(=O)OCC)cc1 |