methyl 4-{5-[(hydroxyimino)methyl]furan-2-yl}benzoate
Chemical Structure Depiction of
methyl 4-{5-[(hydroxyimino)methyl]furan-2-yl}benzoate
methyl 4-{5-[(hydroxyimino)methyl]furan-2-yl}benzoate
Building block characteristics
| Compound ID: | BB52-4339 |
| Compound Name: | methyl 4-{5-[(hydroxyimino)methyl]furan-2-yl}benzoate |
| Molecular Weight: | 245.23 |
| Molecular Formula: | C13 H11 N O4 |
| MFCD Number: | MFCD13187506 |
| Smiles: | COC(c1ccc(cc1)c1ccc(/C=N/O)o1)=O |