5-(3-chloro-2-methylphenyl)furan-2-carboxylic acid
Chemical Structure Depiction of
5-(3-chloro-2-methylphenyl)furan-2-carboxylic acid
5-(3-chloro-2-methylphenyl)furan-2-carboxylic acid
Building block characteristics
| Compound ID: | BB52-4911 |
| Compound Name: | 5-(3-chloro-2-methylphenyl)furan-2-carboxylic acid |
| Molecular Weight: | 236.65 |
| Molecular Formula: | C12 H9 Cl O3 |
| MFCD Number: | MFCD02221244 |
| Smiles: | Cc1c(cccc1[Cl])c1ccc(C(O)=O)o1 |