{5-[2-(trifluoromethyl)phenyl]furan-2-yl}methanol
Chemical Structure Depiction of
{5-[2-(trifluoromethyl)phenyl]furan-2-yl}methanol
{5-[2-(trifluoromethyl)phenyl]furan-2-yl}methanol
Building block characteristics
| Compound ID: | BB52-4944 |
| Compound Name: | {5-[2-(trifluoromethyl)phenyl]furan-2-yl}methanol |
| Molecular Weight: | 242.19 |
| Molecular Formula: | C12 H9 F3 O2 |
| MFCD Number: | MFCD05843240 |
| Smiles: | C(c1ccc(c2ccccc2C(F)(F)F)o1)O |