[5-(2,4-dibromophenyl)furan-2-yl]methanol
Chemical Structure Depiction of
[5-(2,4-dibromophenyl)furan-2-yl]methanol
[5-(2,4-dibromophenyl)furan-2-yl]methanol
Building block characteristics
| Compound ID: | BB52-4946 |
| Compound Name: | [5-(2,4-dibromophenyl)furan-2-yl]methanol |
| Molecular Weight: | 331.99 |
| Molecular Formula: | C11 H8 Br2 O2 |
| MFCD Number: | MFCD05843243 |
| Smiles: | C(c1ccc(c2ccc(cc2[Br])[Br])o1)O |