3,5-dimethyl-1-(2-methylphenyl)-1H-pyrazole-4-carbaldehyde
Chemical Structure Depiction of
3,5-dimethyl-1-(2-methylphenyl)-1H-pyrazole-4-carbaldehyde
3,5-dimethyl-1-(2-methylphenyl)-1H-pyrazole-4-carbaldehyde
Building block characteristics
| Compound ID: | BB52-5654 |
| Compound Name: | 3,5-dimethyl-1-(2-methylphenyl)-1H-pyrazole-4-carbaldehyde |
| Molecular Weight: | 214.26 |
| Molecular Formula: | C13 H14 N2 O |
| CAS Number: | 400757-04-2 |
| MFCD Number: | MFCD07186415 |
| Smiles: | Cc1ccccc1n1c(C)c(C=O)c(C)n1 |