3-ethyl-4-(4-methylphenyl)-1H-pyrazol-5-amine
Chemical Structure Depiction of
3-ethyl-4-(4-methylphenyl)-1H-pyrazol-5-amine
3-ethyl-4-(4-methylphenyl)-1H-pyrazol-5-amine
Building block characteristics
| Compound ID: | BB52-6490 |
| Compound Name: | 3-ethyl-4-(4-methylphenyl)-1H-pyrazol-5-amine |
| Molecular Weight: | 201.27 |
| Molecular Formula: | C12 H15 N3 |
| MFCD Number: | MFCD13811640 |
| Smiles: | CCc1c(c2ccc(C)cc2)c(N)[nH]n1 |