3-phenyl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-thiol
Chemical Structure Depiction of
3-phenyl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-thiol
3-phenyl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-thiol
Building block characteristics
| Compound ID: | BB52-7334 |
| Compound Name: | 3-phenyl[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-thiol |
| Molecular Weight: | 234.3 |
| Molecular Formula: | C9 H6 N4 S2 |
| MFCD Number: | MFCD14525866 |
| Smiles: | c1ccc(cc1)c1nnc2n1nc(S)s2 |