ethyl [(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetate
Chemical Structure Depiction of
ethyl [(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetate
ethyl [(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetate
Building block characteristics
| Compound ID: | BB52-8676 |
| Compound Name: | ethyl [(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]acetate |
| Molecular Weight: | 271.72 |
| Molecular Formula: | C11 H10 Cl N O3 S |
| MFCD Number: | MFCD00127440 |
| Smiles: | CCOC(CSc1nc2cc(ccc2o1)[Cl])=O |