4-fluoro-N-(3-methylthiophene-2-carbonyl)phenylalanine
Chemical Structure Depiction of
4-fluoro-N-(3-methylthiophene-2-carbonyl)phenylalanine
4-fluoro-N-(3-methylthiophene-2-carbonyl)phenylalanine
Building block characteristics
| Compound ID: | BB52-9058 |
| Compound Name: | 4-fluoro-N-(3-methylthiophene-2-carbonyl)phenylalanine |
| Molecular Weight: | 307.34 |
| Molecular Formula: | C15 H14 F N O3 S |
| MFCD Number: | MFCD15208716 |
| Smiles: | Cc1ccsc1C(NC(Cc1ccc(cc1)F)C(O)=O)=O |