3-(4-aminophenyl)-2-phenylprop-2-enoic acid
Chemical Structure Depiction of
3-(4-aminophenyl)-2-phenylprop-2-enoic acid
3-(4-aminophenyl)-2-phenylprop-2-enoic acid
Building block characteristics
| Compound ID: | BB54-2262 |
| Compound Name: | 3-(4-aminophenyl)-2-phenylprop-2-enoic acid |
| Molecular Weight: | 239.27 |
| Molecular Formula: | C15 H13 N O2 |
| MFCD Number: | MFCD08061139 |
| Smiles: | C(=C(C(O)=O)/c1ccccc1)\c1ccc(cc1)N |