1-[rel-(2R,3S)-2-(2,4-dimethoxyphenyl)-1-ethylpyrrolidin-3-yl]-N-methylmethanamine dihydrochloride
Chemical Structure Depiction of
1-[rel-(2R,3S)-2-(2,4-dimethoxyphenyl)-1-ethylpyrrolidin-3-yl]-N-methylmethanamine dihydrochloride
1-[rel-(2R,3S)-2-(2,4-dimethoxyphenyl)-1-ethylpyrrolidin-3-yl]-N-methylmethanamine dihydrochloride
Building block characteristics
| Compound ID: | BB54-3144 |
| Compound Name: | 1-[rel-(2R,3S)-2-(2,4-dimethoxyphenyl)-1-ethylpyrrolidin-3-yl]-N-methylmethanamine dihydrochloride |
| Molecular Weight: | 278.39 |
| Molecular Formula: | C16 H26 N2 O2 |
| MFCD Number: | MFCD08146640 |
| Salt: | 2HCl |
| Smiles: | CCN1CC[C@@H](CNC)[C@@H]1c1ccc(cc1OC)OC |