methyl 5-acetyl-1H-pyrazole-3-carboxylate
Chemical Structure Depiction of
methyl 5-acetyl-1H-pyrazole-3-carboxylate
methyl 5-acetyl-1H-pyrazole-3-carboxylate
Building block characteristics
| Compound ID: | BB54-3642 |
| Compound Name: | methyl 5-acetyl-1H-pyrazole-3-carboxylate |
| Molecular Weight: | 168.15 |
| Molecular Formula: | C7 H8 N2 O3 |
| CAS Number: | 684236-66-6 |
| MFCD Number: | MFCD09028401 |
| Smiles: | CC(c1cc(C(=O)OC)n[nH]1)=O |