7-(chloromethyl)-4,5,6-triethoxy-2-benzofuran-1(3H)-one
Chemical Structure Depiction of
7-(chloromethyl)-4,5,6-triethoxy-2-benzofuran-1(3H)-one
7-(chloromethyl)-4,5,6-triethoxy-2-benzofuran-1(3H)-one
Building block characteristics
| Compound ID: | BB54-3648 |
| Compound Name: | 7-(chloromethyl)-4,5,6-triethoxy-2-benzofuran-1(3H)-one |
| Molecular Weight: | 314.76 |
| Molecular Formula: | C15 H19 Cl O5 |
| MFCD Number: | MFCD09028406 |
| Smiles: | CCOc1c2COC(c2c(C[Cl])c(c1OCC)OCC)=O |