(4-chlorophenyl)-N'-hydroxyethanimidamide
Chemical Structure Depiction of
(4-chlorophenyl)-N'-hydroxyethanimidamide
(4-chlorophenyl)-N'-hydroxyethanimidamide
Building block characteristics
| Compound ID: | BB54-5317 |
| Compound Name: | (4-chlorophenyl)-N'-hydroxyethanimidamide |
| Molecular Weight: | 184.62 |
| Molecular Formula: | C8 H9 Cl N2 O |
| CAS Number: | 6965-39-5 |
| MFCD Number: | MFCD00844471 |
| Smiles: | C(/C(N)=N/O)c1ccc(cc1)[Cl] |