N-[(3,4-dimethoxyphenyl)methyl]-1H-benzotriazol-7-amine
Chemical Structure Depiction of
N-[(3,4-dimethoxyphenyl)methyl]-1H-benzotriazol-7-amine
N-[(3,4-dimethoxyphenyl)methyl]-1H-benzotriazol-7-amine
Building block characteristics
| Compound ID: | BB54-5478 |
| Compound Name: | N-[(3,4-dimethoxyphenyl)methyl]-1H-benzotriazol-7-amine |
| Molecular Weight: | 284.32 |
| Molecular Formula: | C15 H16 N4 O2 |
| MFCD Number: | MFCD06654862 |
| Smiles: | COc1ccc(CNc2cccc3c2[nH]nn3)cc1OC |