2-(4-nitrophenyl)acetohydrazide
Chemical Structure Depiction of
2-(4-nitrophenyl)acetohydrazide
2-(4-nitrophenyl)acetohydrazide
Building block characteristics
| Compound ID: | BB55-0708 |
| Compound Name: | 2-(4-nitrophenyl)acetohydrazide |
| Molecular Weight: | 195.17 |
| Molecular Formula: | C8 H9 N3 O3 |
| CAS Number: | 6144-81-6 |
| MFCD Number: | MFCD01001352 |
| Smiles: | C(C(NN)=O)c1ccc(cc1)[N+]([O-])=O |