1-benzyl-3-phenyl-1H-pyrazole-4-carbaldehyde
Chemical Structure Depiction of
1-benzyl-3-phenyl-1H-pyrazole-4-carbaldehyde
1-benzyl-3-phenyl-1H-pyrazole-4-carbaldehyde
Building block characteristics
| Compound ID: | BB55-0802 |
| Compound Name: | 1-benzyl-3-phenyl-1H-pyrazole-4-carbaldehyde |
| Molecular Weight: | 262.31 |
| Molecular Formula: | C17 H14 N2 O |
| CAS Number: | 588687-35-8 |
| MFCD Number: | MFCD03422329 |
| Smiles: | C(c1ccccc1)n1cc(C=O)c(c2ccccc2)n1 |