1-[(2-fluorophenyl)methyl]-3-phenyl-1H-pyrazole-4-carbaldehyde
Chemical Structure Depiction of
1-[(2-fluorophenyl)methyl]-3-phenyl-1H-pyrazole-4-carbaldehyde
1-[(2-fluorophenyl)methyl]-3-phenyl-1H-pyrazole-4-carbaldehyde
Building block characteristics
| Compound ID: | BB55-0803 |
| Compound Name: | 1-[(2-fluorophenyl)methyl]-3-phenyl-1H-pyrazole-4-carbaldehyde |
| Molecular Weight: | 280.3 |
| Molecular Formula: | C17 H13 F N2 O |
| CAS Number: | 1006449-72-4 |
| MFCD Number: | MFCD03422330 |
| Smiles: | C(c1ccccc1F)n1cc(C=O)c(c2ccccc2)n1 |