1-[(3-chlorophenyl)methyl]-3-phenyl-1H-pyrazole-4-carbaldehyde
Chemical Structure Depiction of
1-[(3-chlorophenyl)methyl]-3-phenyl-1H-pyrazole-4-carbaldehyde
1-[(3-chlorophenyl)methyl]-3-phenyl-1H-pyrazole-4-carbaldehyde
Building block characteristics
| Compound ID: | BB55-0806 |
| Compound Name: | 1-[(3-chlorophenyl)methyl]-3-phenyl-1H-pyrazole-4-carbaldehyde |
| Molecular Weight: | 296.75 |
| Molecular Formula: | C17 H13 Cl N2 O |
| CAS Number: | 1006472-07-6 |
| MFCD Number: | MFCD03422333 |
| Smiles: | C(c1cccc(c1)[Cl])n1cc(C=O)c(c2ccccc2)n1 |