4-[(3-methoxyphenyl)methoxy]benzaldehyde
Chemical Structure Depiction of
4-[(3-methoxyphenyl)methoxy]benzaldehyde
4-[(3-methoxyphenyl)methoxy]benzaldehyde
Building block characteristics
| Compound ID: | BB55-0941 |
| Compound Name: | 4-[(3-methoxyphenyl)methoxy]benzaldehyde |
| Molecular Weight: | 242.27 |
| Molecular Formula: | C15 H14 O3 |
| CAS Number: | 161192-29-6 |
| MFCD Number: | MFCD03422468 |
| Smiles: | COc1cccc(COc2ccc(C=O)cc2)c1 |