propan-2-yl 2-amino-4-[4-(propan-2-yl)phenyl]thiophene-3-carboxylate
Chemical Structure Depiction of
propan-2-yl 2-amino-4-[4-(propan-2-yl)phenyl]thiophene-3-carboxylate
propan-2-yl 2-amino-4-[4-(propan-2-yl)phenyl]thiophene-3-carboxylate
Building block characteristics
| Compound ID: | BB55-1286 |
| Compound Name: | propan-2-yl 2-amino-4-[4-(propan-2-yl)phenyl]thiophene-3-carboxylate |
| Molecular Weight: | 303.42 |
| Molecular Formula: | C17 H21 N O2 S |
| CAS Number: | 351157-20-5 |
| MFCD Number: | MFCD01923355 |
| Smiles: | CC(C)c1ccc(cc1)c1csc(c1C(=O)OC(C)C)N |