methyl 2-amino-4-(3,4-dimethylphenyl)-5-methylthiophene-3-carboxylate
Chemical Structure Depiction of
methyl 2-amino-4-(3,4-dimethylphenyl)-5-methylthiophene-3-carboxylate
methyl 2-amino-4-(3,4-dimethylphenyl)-5-methylthiophene-3-carboxylate
Building block characteristics
| Compound ID: | BB55-1303 |
| Compound Name: | methyl 2-amino-4-(3,4-dimethylphenyl)-5-methylthiophene-3-carboxylate |
| Molecular Weight: | 275.37 |
| Molecular Formula: | C15 H17 N O2 S |
| CAS Number: | 350989-74-1 |
| MFCD Number: | MFCD01922154 |
| Smiles: | Cc1ccc(cc1C)c1c(C(=O)OC)c(N)sc1C |