2-amino-N-(2-fluorophenyl)thiophene-3-carboxamide
Chemical Structure Depiction of
2-amino-N-(2-fluorophenyl)thiophene-3-carboxamide
2-amino-N-(2-fluorophenyl)thiophene-3-carboxamide
Building block characteristics
| Compound ID: | BB55-1596 |
| Compound Name: | 2-amino-N-(2-fluorophenyl)thiophene-3-carboxamide |
| Molecular Weight: | 236.26 |
| Molecular Formula: | C11 H9 F N2 O S |
| CAS Number: | 590356-74-4 |
| MFCD Number: | MFCD03946006 |
| Smiles: | c1ccc(c(c1)NC(c1ccsc1N)=O)F |