4-isothiocyanato-N-(2-phenylethyl)benzene-1-sulfonamide
Chemical Structure Depiction of
4-isothiocyanato-N-(2-phenylethyl)benzene-1-sulfonamide
4-isothiocyanato-N-(2-phenylethyl)benzene-1-sulfonamide
Building block characteristics
| Compound ID: | BB55-2478 |
| Compound Name: | 4-isothiocyanato-N-(2-phenylethyl)benzene-1-sulfonamide |
| Molecular Weight: | 318.41 |
| Molecular Formula: | C15 H14 N2 O2 S2 |
| MFCD Number: | MFCD09971959 |
| Smiles: | C(CNS(c1ccc(cc1)N=C=S)(=O)=O)c1ccccc1 |