5-(3,4-dichlorophenyl)-4-methyl-4H-1,2,4-triazole-3-thiol
Chemical Structure Depiction of
5-(3,4-dichlorophenyl)-4-methyl-4H-1,2,4-triazole-3-thiol
5-(3,4-dichlorophenyl)-4-methyl-4H-1,2,4-triazole-3-thiol
Building block characteristics
| Compound ID: | BB55-2604 |
| Compound Name: | 5-(3,4-dichlorophenyl)-4-methyl-4H-1,2,4-triazole-3-thiol |
| Molecular Weight: | 260.14 |
| Molecular Formula: | C9 H7 Cl2 N3 S |
| CAS Number: | 725217-53-8 |
| MFCD Number: | MFCD01940420 |
| Smiles: | Cn1c(c2ccc(c(c2)[Cl])[Cl])nnc1S |