4-ethyl-5-[4-(2-methylpropoxy)phenyl]-4H-1,2,4-triazole-3-thiol
Chemical Structure Depiction of
4-ethyl-5-[4-(2-methylpropoxy)phenyl]-4H-1,2,4-triazole-3-thiol
4-ethyl-5-[4-(2-methylpropoxy)phenyl]-4H-1,2,4-triazole-3-thiol
Building block characteristics
| Compound ID: | BB55-2643 |
| Compound Name: | 4-ethyl-5-[4-(2-methylpropoxy)phenyl]-4H-1,2,4-triazole-3-thiol |
| Molecular Weight: | 277.39 |
| Molecular Formula: | C14 H19 N3 O S |
| CAS Number: | 725244-84-8 |
| MFCD Number: | MFCD04968876 |
| Smiles: | CCn1c(c2ccc(cc2)OCC(C)C)nnc1S |