5-[(4-methylphenoxy)methyl]-4-(prop-2-en-1-yl)-4H-1,2,4-triazole-3-thiol
Chemical Structure Depiction of
5-[(4-methylphenoxy)methyl]-4-(prop-2-en-1-yl)-4H-1,2,4-triazole-3-thiol
5-[(4-methylphenoxy)methyl]-4-(prop-2-en-1-yl)-4H-1,2,4-triazole-3-thiol
Building block characteristics
| Compound ID: | BB55-2739 |
| Compound Name: | 5-[(4-methylphenoxy)methyl]-4-(prop-2-en-1-yl)-4H-1,2,4-triazole-3-thiol |
| Molecular Weight: | 261.34 |
| Molecular Formula: | C13 H15 N3 O S |
| CAS Number: | 669709-47-1 |
| MFCD Number: | MFCD04058003 |
| Smiles: | Cc1ccc(cc1)OCc1nnc(n1CC=C)S |