3-chloro-N-(2,3-dihydro-1H-inden-5-yl)propanamide
Chemical Structure Depiction of
3-chloro-N-(2,3-dihydro-1H-inden-5-yl)propanamide
3-chloro-N-(2,3-dihydro-1H-inden-5-yl)propanamide
Building block characteristics
| Compound ID: | BB55-2934 |
| Compound Name: | 3-chloro-N-(2,3-dihydro-1H-inden-5-yl)propanamide |
| Molecular Weight: | 223.7 |
| Molecular Formula: | C12 H14 Cl N O |
| CAS Number: | 908494-47-3 |
| MFCD Number: | MFCD08593324 |
| Smiles: | C1Cc2ccc(cc2C1)NC(CC[Cl])=O |