3-chloro-N-(2,4,6-trimethylphenyl)propanamide
Chemical Structure Depiction of
3-chloro-N-(2,4,6-trimethylphenyl)propanamide
3-chloro-N-(2,4,6-trimethylphenyl)propanamide
Building block characteristics
| Compound ID: | BB55-2936 |
| Compound Name: | 3-chloro-N-(2,4,6-trimethylphenyl)propanamide |
| Molecular Weight: | 225.72 |
| Molecular Formula: | C12 H16 Cl N O |
| CAS Number: | 100141-43-3 |
| MFCD Number: | MFCD03385087 |
| Smiles: | Cc1cc(C)c(c(C)c1)NC(CC[Cl])=O |