4-[(4-chlorophenyl)methoxy]benzoic acid
Chemical Structure Depiction of
4-[(4-chlorophenyl)methoxy]benzoic acid
4-[(4-chlorophenyl)methoxy]benzoic acid
Building block characteristics
| Compound ID: | BB55-4339 |
| Compound Name: | 4-[(4-chlorophenyl)methoxy]benzoic acid |
| Molecular Weight: | 262.69 |
| Molecular Formula: | C14 H11 Cl O3 |
| CAS Number: | 62290-40-8 |
| MFCD Number: | MFCD04521327 |
| Smiles: | C(c1ccc(cc1)[Cl])Oc1ccc(cc1)C(O)=O |