5-bromo-2-[(4-fluorophenyl)methoxy]benzoic acid
Chemical Structure Depiction of
5-bromo-2-[(4-fluorophenyl)methoxy]benzoic acid
5-bromo-2-[(4-fluorophenyl)methoxy]benzoic acid
Building block characteristics
| Compound ID: | BB55-4351 |
| Compound Name: | 5-bromo-2-[(4-fluorophenyl)methoxy]benzoic acid |
| Molecular Weight: | 325.13 |
| Molecular Formula: | C14 H10 Br F O3 |
| CAS Number: | 938243-43-7 |
| MFCD Number: | MFCD09720926 |
| Smiles: | C(c1ccc(cc1)F)Oc1ccc(cc1C(O)=O)[Br] |