2-{[2-(4-chlorophenyl)ethyl]sulfanyl}benzoic acid
Chemical Structure Depiction of
2-{[2-(4-chlorophenyl)ethyl]sulfanyl}benzoic acid
2-{[2-(4-chlorophenyl)ethyl]sulfanyl}benzoic acid
Building block characteristics
| Compound ID: | BB55-4666 |
| Compound Name: | 2-{[2-(4-chlorophenyl)ethyl]sulfanyl}benzoic acid |
| Molecular Weight: | 292.78 |
| Molecular Formula: | C15 H13 Cl O2 S |
| CAS Number: | 1142202-47-8 |
| MFCD Number: | MFCD12028227 |
| Smiles: | C(CSc1ccccc1C(O)=O)c1ccc(cc1)[Cl] |