2-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-isoindol-2-yl)-3-phenylpropanoic acid
Chemical Structure Depiction of
2-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-isoindol-2-yl)-3-phenylpropanoic acid
2-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-isoindol-2-yl)-3-phenylpropanoic acid
Building block characteristics
| Compound ID: | BB55-5080 |
| Compound Name: | 2-(1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-isoindol-2-yl)-3-phenylpropanoic acid |
| Molecular Weight: | 299.32 |
| Molecular Formula: | C17 H17 N O4 |
| MFCD Number: | MFCD09735585 |
| Smiles: | C1C=CCC2C1C(N(C(Cc1ccccc1)C(O)=O)C2=O)=O |