methyl 2-(bromomethyl)-3-nitrobenzoate
Chemical Structure Depiction of
methyl 2-(bromomethyl)-3-nitrobenzoate
methyl 2-(bromomethyl)-3-nitrobenzoate
Building block characteristics
| Compound ID: | BB55-8440 |
| Compound Name: | methyl 2-(bromomethyl)-3-nitrobenzoate |
| Molecular Weight: | 274.07 |
| Molecular Formula: | C9 H8 Br N O4 |
| CAS Number: | 98475-07-1 |
| MFCD Number: | MFCD04114315 |
| Smiles: | COC(c1cccc(c1C[Br])[N+]([O-])=O)=O |